C14H16N2O4S — CID 79031900
methyl (3S)-1-(4-cyanophenyl)sulfonylpiperidine-3-carboxylate (PubChem CID 79031900) has the molecular formula C14H16N2O4S and a molecular weight of 308.36 g/mol. Its IUPAC name is methyl (3S)-1-(4-cyanophenyl)sulfonylpiperidine-3-carboxylate.
| Compound Name | methyl (3S)-1-(4-cyanophenyl)sulfonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 79031900 |
| Molecular Formula | C14H16N2O4S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | methyl (3S)-1-(4-cyanophenyl)sulfonylpiperidine-3-carboxylate |
| SMILES | COC(=O)[C@H]1CCCN(S(=O)(=O)c2ccc(C#N)cc2)C1 |
| InChI | InChI=1S/C14H16N2O4S/c1-20-14(17)12-3-2-8-16(10-12)21(18,19)13-6-4-11(9-15)5-7-13/h4-7,12H,2-3,8,10H2,1H3/t12-/m0/s1 |
| InChIKey | JBJPPKQVVMCGQP-LBPRGKRZSA-N |
| XLogP | 1.13 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |