C13H15N3O4S — CID 106545929
methyl 1-[(2-cyano-3-pyridinyl)sulfonyl]piperidine-3-carboxylate (PubChem CID 106545929) has the molecular formula C13H15N3O4S and a molecular weight of 309.35 g/mol. Its IUPAC name is methyl 1-[(2-cyano-3-pyridinyl)sulfonyl]piperidine-3-carboxylate.
| Compound Name | methyl 1-[(2-cyano-3-pyridinyl)sulfonyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 106545929 |
| Molecular Formula | C13H15N3O4S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | methyl 1-[(2-cyano-3-pyridinyl)sulfonyl]piperidine-3-carboxylate |
| SMILES | COC(=O)C1CCCN(S(=O)(=O)c2cccnc2C#N)C1 |
| InChI | InChI=1S/C13H15N3O4S/c1-20-13(17)10-4-3-7-16(9-10)21(18,19)12-5-2-6-15-11(12)8-14/h2,5-6,10H,3-4,7,9H2,1H3 |
| InChIKey | LBYFKXMYHBFYMS-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 100.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |