C12H17N3O4S — CID 115533411
methyl 1-[(2-amino-3-pyridinyl)sulfonyl]piperidine-3-carboxylate (PubChem CID 115533411) has the molecular formula C12H17N3O4S and a molecular weight of 299.35 g/mol. Its IUPAC name is methyl 1-[(2-amino-3-pyridinyl)sulfonyl]piperidine-3-carboxylate.
| Compound Name | methyl 1-[(2-amino-3-pyridinyl)sulfonyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 115533411 |
| Molecular Formula | C12H17N3O4S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | methyl 1-[(2-amino-3-pyridinyl)sulfonyl]piperidine-3-carboxylate |
| SMILES | COC(=O)C1CCCN(S(=O)(=O)c2cccnc2N)C1 |
| InChI | InChI=1S/C12H17N3O4S/c1-19-12(16)9-4-3-7-15(8-9)20(17,18)10-5-2-6-14-11(10)13/h2,5-6,9H,3-4,7-8H2,1H3,(H2,13,14) |
| InChIKey | CONKLDVANWHLCO-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 102.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |