C13H18N4O3S — CID 65425898
[4-[(2-amino-3-pyridinyl)sulfonyl]piperazin-1-yl]-cyclopropylmethanone (PubChem CID 65425898) has the molecular formula C13H18N4O3S and a molecular weight of 310.38 g/mol. Its IUPAC name is [4-[(2-amino-3-pyridinyl)sulfonyl]piperazin-1-yl]-cyclopropylmethanone.
| Compound Name | [4-[(2-amino-3-pyridinyl)sulfonyl]piperazin-1-yl]-cyclopropylmethanone |
|---|---|
| PubChem CID | 65425898 |
| Molecular Formula | C13H18N4O3S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | [4-[(2-amino-3-pyridinyl)sulfonyl]piperazin-1-yl]-cyclopropylmethanone |
| SMILES | Nc1ncccc1S(=O)(=O)N1CCN(C(=O)C2CC2)CC1 |
| InChI | InChI=1S/C13H18N4O3S/c14-12-11(2-1-5-15-12)21(19,20)17-8-6-16(7-9-17)13(18)10-3-4-10/h1-2,5,10H,3-4,6-9H2,(H2,14,15) |
| InChIKey | QPAMMXYULFLTSO-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 96.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |