C10H16N4O4S2 — CID 62992089
3-(4-methylsulfonylpiperazin-1-yl)sulfonylpyridin-2-amine (PubChem CID 62992089) has the molecular formula C10H16N4O4S2 and a molecular weight of 320.40 g/mol. Its IUPAC name is 3-(4-methylsulfonylpiperazin-1-yl)sulfonylpyridin-2-amine.
| Compound Name | 3-(4-methylsulfonylpiperazin-1-yl)sulfonylpyridin-2-amine |
|---|---|
| PubChem CID | 62992089 |
| Molecular Formula | C10H16N4O4S2 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 3-(4-methylsulfonylpiperazin-1-yl)sulfonylpyridin-2-amine |
| SMILES | CS(=O)(=O)N1CCN(S(=O)(=O)c2cccnc2N)CC1 |
| InChI | InChI=1S/C10H16N4O4S2/c1-19(15,16)13-5-7-14(8-6-13)20(17,18)9-3-2-4-12-10(9)11/h2-4H,5-8H2,1H3,(H2,11,12) |
| InChIKey | CWWYLAAPVUDRQL-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 113.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |