C14H21N3O2S — CID 102725260
3-[[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]sulfonyl]pyridin-2-amine (PubChem CID 102725260) has the molecular formula C14H21N3O2S and a molecular weight of 295.41 g/mol. Its IUPAC name is 3-[[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]sulfonyl]pyridin-2-amine.
| Compound Name | 3-[[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]sulfonyl]pyridin-2-amine |
|---|---|
| PubChem CID | 102725260 |
| Molecular Formula | C14H21N3O2S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 3-[[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]sulfonyl]pyridin-2-amine |
| SMILES | Nc1ncccc1S(=O)(=O)N1CCC[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C14H21N3O2S/c15-14-13(8-3-9-16-14)20(18,19)17-10-4-6-11-5-1-2-7-12(11)17/h3,8-9,11-12H,1-2,4-7,10H2,(H2,15,16)/t11-,12-/m1/s1 |
| InChIKey | ILISREYPRVFBDP-VXGBXAGGSA-N |
| XLogP | 2.01 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |