C12H16N4O3S — CID 103194290
1-[(2-amino-3-pyridinyl)sulfonyl]-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one (PubChem CID 103194290) has the molecular formula C12H16N4O3S and a molecular weight of 296.35 g/mol. Its IUPAC name is 1-[(2-amino-3-pyridinyl)sulfonyl]-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one.
| Compound Name | 1-[(2-amino-3-pyridinyl)sulfonyl]-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 103194290 |
| Molecular Formula | C12H16N4O3S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 1-[(2-amino-3-pyridinyl)sulfonyl]-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one |
| SMILES | Nc1ncccc1S(=O)(=O)N1CCCC2C(=O)NCC21 |
| InChI | InChI=1S/C12H16N4O3S/c13-11-10(4-1-5-14-11)20(18,19)16-6-2-3-8-9(16)7-15-12(8)17/h1,4-5,8-9H,2-3,6-7H2,(H2,13,14)(H,15,17) |
| InChIKey | HINFNOLMSVUBNY-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |