C14H15N3O3S — CID 103195778
3-[(5-oxo-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl)sulfonyl]benzonitrile (PubChem CID 103195778) has the molecular formula C14H15N3O3S and a molecular weight of 305.36 g/mol. Its IUPAC name is 3-[(5-oxo-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl)sulfonyl]benzonitrile.
| Compound Name | 3-[(5-oxo-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl)sulfonyl]benzonitrile |
|---|---|
| PubChem CID | 103195778 |
| Molecular Formula | C14H15N3O3S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 3-[(5-oxo-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl)sulfonyl]benzonitrile |
| SMILES | N#Cc1cccc(S(=O)(=O)N2CCCC3C(=O)NCC32)c1 |
| InChI | InChI=1S/C14H15N3O3S/c15-8-10-3-1-4-11(7-10)21(19,20)17-6-2-5-12-13(17)9-16-14(12)18/h1,3-4,7,12-13H,2,5-6,9H2,(H,16,18) |
| InChIKey | NVJQWBIDAAITMS-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |