C13H16BrN3O3S — CID 103194265
1-(4-amino-3-bromophenyl)sulfonyl-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one (PubChem CID 103194265) has the molecular formula C13H16BrN3O3S and a molecular weight of 374.26 g/mol. Its IUPAC name is 1-(4-amino-3-bromophenyl)sulfonyl-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one.
| Compound Name | 1-(4-amino-3-bromophenyl)sulfonyl-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 103194265 |
| Molecular Formula | C13H16BrN3O3S |
| Molecular Weight | 374.26 g/mol |
| Exact Mass | 373.01 |
| IUPAC Name | 1-(4-amino-3-bromophenyl)sulfonyl-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one |
| SMILES | Nc1ccc(S(=O)(=O)N2CCCC3C(=O)NCC32)cc1Br |
| InChI | InChI=1S/C13H16BrN3O3S/c14-10-6-8(3-4-11(10)15)21(19,20)17-5-1-2-9-12(17)7-16-13(9)18/h3-4,6,9,12H,1-2,5,7,15H2,(H,16,18) |
| InChIKey | VWUWHTRWYBQETQ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.26 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|