C13H15BrN2O3S — CID 103197720
1-(3-bromophenyl)sulfonyl-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one (PubChem CID 103197720) has the molecular formula C13H15BrN2O3S and a molecular weight of 359.25 g/mol. Its IUPAC name is 1-(3-bromophenyl)sulfonyl-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one.
| Compound Name | 1-(3-bromophenyl)sulfonyl-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 103197720 |
| Molecular Formula | C13H15BrN2O3S |
| Molecular Weight | 359.25 g/mol |
| Exact Mass | 358.00 |
| IUPAC Name | 1-(3-bromophenyl)sulfonyl-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one |
| SMILES | O=C1NCC2C1CCCN2S(=O)(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C13H15BrN2O3S/c14-9-3-1-4-10(7-9)20(18,19)16-6-2-5-11-12(16)8-15-13(11)17/h1,3-4,7,11-12H,2,5-6,8H2,(H,15,17) |
| InChIKey | VZFNHSFWGBHORK-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.25 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |