C12H13N3O3S — CID 62898760
3-[(3-oxo-1,4-diazepan-1-yl)sulfonyl]benzonitrile (PubChem CID 62898760) has the molecular formula C12H13N3O3S and a molecular weight of 279.32 g/mol. Its IUPAC name is 3-[(3-oxo-1,4-diazepan-1-yl)sulfonyl]benzonitrile.
| Compound Name | 3-[(3-oxo-1,4-diazepan-1-yl)sulfonyl]benzonitrile |
|---|---|
| PubChem CID | 62898760 |
| Molecular Formula | C12H13N3O3S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 3-[(3-oxo-1,4-diazepan-1-yl)sulfonyl]benzonitrile |
| SMILES | N#Cc1cccc(S(=O)(=O)N2CCCNC(=O)C2)c1 |
| InChI | InChI=1S/C12H13N3O3S/c13-8-10-3-1-4-11(7-10)19(17,18)15-6-2-5-14-12(16)9-15/h1,3-4,7H,2,5-6,9H2,(H,14,16) |
| InChIKey | OFYMESKOXJKPLM-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |