C17H16N4O5S2 — CID 39875664
3-cyano-N-[3-(3-oxopiperazin-1-yl)sulfonylphenyl]benzenesulfonamide (PubChem CID 39875664) has the molecular formula C17H16N4O5S2 and a molecular weight of 420.47 g/mol. Its IUPAC name is 3-cyano-N-[3-(3-oxopiperazin-1-yl)sulfonylphenyl]benzenesulfonamide.
| Compound Name | 3-cyano-N-[3-(3-oxopiperazin-1-yl)sulfonylphenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 39875664 |
| Molecular Formula | C17H16N4O5S2 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | 3-cyano-N-[3-(3-oxopiperazin-1-yl)sulfonylphenyl]benzenesulfonamide |
| SMILES | N#Cc1cccc(S(=O)(=O)Nc2cccc(S(=O)(=O)N3CCNC(=O)C3)c2)c1 |
| InChI | InChI=1S/C17H16N4O5S2/c18-11-13-3-1-5-15(9-13)27(23,24)20-14-4-2-6-16(10-14)28(25,26)21-8-7-19-17(22)12-21/h1-6,9-10,20H,7-8,12H2,(H,19,22) |
| InChIKey | DCEJRGBZGXAAOQ-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 136.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |