C16H24N4O4S — CID 119713483
(2S)-2-amino-3,3-dimethyl-N-[3-(3-oxopiperazin-1-yl)sulfonylphenyl]butanamide (PubChem CID 119713483) has the molecular formula C16H24N4O4S and a molecular weight of 368.46 g/mol. Its IUPAC name is (2S)-2-amino-3,3-dimethyl-N-[3-(3-oxopiperazin-1-yl)sulfonylphenyl]butanamide.
| Compound Name | (2S)-2-amino-3,3-dimethyl-N-[3-(3-oxopiperazin-1-yl)sulfonylphenyl]butanamide |
|---|---|
| PubChem CID | 119713483 |
| Molecular Formula | C16H24N4O4S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | (2S)-2-amino-3,3-dimethyl-N-[3-(3-oxopiperazin-1-yl)sulfonylphenyl]butanamide |
| SMILES | CC(C)(C)[C@H](N)C(=O)Nc1cccc(S(=O)(=O)N2CCNC(=O)C2)c1 |
| InChI | InChI=1S/C16H24N4O4S/c1-16(2,3)14(17)15(22)19-11-5-4-6-12(9-11)25(23,24)20-8-7-18-13(21)10-20/h4-6,9,14H,7-8,10,17H2,1-3H3,(H,18,21)(H,19,22)/t14-/m1/s1 |
| InChIKey | ZQCBRLJZIPUHDJ-CQSZACIVSA-N |
| XLogP | 0.12 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |