C19H28N4O6S — CID 55762447
tert-butyl N-[4-oxo-4-[3-(3-oxopiperazin-1-yl)sulfonylanilino]butyl]carbamate (PubChem CID 55762447) has the molecular formula C19H28N4O6S and a molecular weight of 440.52 g/mol. Its IUPAC name is tert-butyl N-[4-oxo-4-[3-(3-oxopiperazin-1-yl)sulfonylanilino]butyl]carbamate.
| Compound Name | tert-butyl N-[4-oxo-4-[3-(3-oxopiperazin-1-yl)sulfonylanilino]butyl]carbamate |
|---|---|
| PubChem CID | 55762447 |
| Molecular Formula | C19H28N4O6S |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | tert-butyl N-[4-oxo-4-[3-(3-oxopiperazin-1-yl)sulfonylanilino]butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC(=O)Nc1cccc(S(=O)(=O)N2CCNC(=O)C2)c1 |
| InChI | InChI=1S/C19H28N4O6S/c1-19(2,3)29-18(26)21-9-5-8-16(24)22-14-6-4-7-15(12-14)30(27,28)23-11-10-20-17(25)13-23/h4,6-7,12H,5,8-11,13H2,1-3H3,(H,20,25)(H,21,26)(H,22,24) |
| InChIKey | RXBUDJOSOILMJJ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|