C21H20N4O4S2 — CID 55664739
N-[3-(3-oxopiperazin-1-yl)sulfonylphenyl]-2-(2-phenyl-1,3-thiazol-4-yl)acetamide (PubChem CID 55664739) has the molecular formula C21H20N4O4S2 and a molecular weight of 456.55 g/mol. Its IUPAC name is N-[3-(3-oxopiperazin-1-yl)sulfonylphenyl]-2-(2-phenyl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-[3-(3-oxopiperazin-1-yl)sulfonylphenyl]-2-(2-phenyl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 55664739 |
| Molecular Formula | C21H20N4O4S2 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | N-[3-(3-oxopiperazin-1-yl)sulfonylphenyl]-2-(2-phenyl-1,3-thiazol-4-yl)acetamide |
| SMILES | O=C1CN(S(=O)(=O)c2cccc(NC(=O)Cc3csc(-c4ccccc4)n3)c2)CCN1 |
| InChI | InChI=1S/C21H20N4O4S2/c26-19(12-17-14-30-21(24-17)15-5-2-1-3-6-15)23-16-7-4-8-18(11-16)31(28,29)25-10-9-22-20(27)13-25/h1-8,11,14H,9-10,12-13H2,(H,22,27)(H,23,26) |
| InChIKey | YVWMVIHEZSPDEZ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |