C21H22ClN3O3S2 — CID 16560776
2-[2-(3-chlorophenyl)-1,3-thiazol-4-yl]-N-[3-(diethylsulfamoyl)phenyl]acetamide (PubChem CID 16560776) has the molecular formula C21H22ClN3O3S2 and a molecular weight of 464.01 g/mol. Its IUPAC name is 2-[2-(3-chlorophenyl)-1,3-thiazol-4-yl]-N-[3-(diethylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-[2-(3-chlorophenyl)-1,3-thiazol-4-yl]-N-[3-(diethylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 16560776 |
| Molecular Formula | C21H22ClN3O3S2 |
| Molecular Weight | 464.01 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | 2-[2-(3-chlorophenyl)-1,3-thiazol-4-yl]-N-[3-(diethylsulfamoyl)phenyl]acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(NC(=O)Cc2csc(-c3cccc(Cl)c3)n2)c1 |
| InChI | InChI=1S/C21H22ClN3O3S2/c1-3-25(4-2)30(27,28)19-10-6-9-17(12-19)23-20(26)13-18-14-29-21(24-18)15-7-5-8-16(22)11-15/h5-12,14H,3-4,13H2,1-2H3,(H,23,26) |
| InChIKey | LTFVQTCKEQGVJZ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.01 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |