C17H14N2O2S — CID 78783427
N-(3-hydroxyphenyl)-2-(2-phenyl-1,3-thiazol-4-yl)acetamide (PubChem CID 78783427) has the molecular formula C17H14N2O2S and a molecular weight of 310.38 g/mol. Its IUPAC name is N-(3-hydroxyphenyl)-2-(2-phenyl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-(3-hydroxyphenyl)-2-(2-phenyl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 78783427 |
| Molecular Formula | C17H14N2O2S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | N-(3-hydroxyphenyl)-2-(2-phenyl-1,3-thiazol-4-yl)acetamide |
| SMILES | O=C(Cc1csc(-c2ccccc2)n1)Nc1cccc(O)c1 |
| InChI | InChI=1S/C17H14N2O2S/c20-15-8-4-7-13(9-15)18-16(21)10-14-11-22-17(19-14)12-5-2-1-3-6-12/h1-9,11,20H,10H2,(H,18,21) |
| InChIKey | RNXFMVFWPJTENW-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |