C17H12Cl2N2OS — CID 2100218
N-(2,3-dichlorophenyl)-2-(2-phenyl-1,3-thiazol-4-yl)acetamide (PubChem CID 2100218) has the molecular formula C17H12Cl2N2OS and a molecular weight of 363.27 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-2-(2-phenyl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-(2,3-dichlorophenyl)-2-(2-phenyl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 2100218 |
| Molecular Formula | C17H12Cl2N2OS |
| Molecular Weight | 363.27 g/mol |
| Exact Mass | 362.00 |
| IUPAC Name | N-(2,3-dichlorophenyl)-2-(2-phenyl-1,3-thiazol-4-yl)acetamide |
| SMILES | O=C(Cc1csc(-c2ccccc2)n1)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C17H12Cl2N2OS/c18-13-7-4-8-14(16(13)19)21-15(22)9-12-10-23-17(20-12)11-5-2-1-3-6-11/h1-8,10H,9H2,(H,21,22) |
| InChIKey | ZRQPWQVGQYPFRX-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.27 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |