C18H15ClN2OS — CID 7667740
2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]-N-(2-methylphenyl)acetamide (PubChem CID 7667740) has the molecular formula C18H15ClN2OS and a molecular weight of 342.85 g/mol. Its IUPAC name is 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 7667740 |
| Molecular Formula | C18H15ClN2OS |
| Molecular Weight | 342.85 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]-N-(2-methylphenyl)acetamide |
| SMILES | Cc1ccccc1NC(=O)Cc1csc(-c2ccccc2Cl)n1 |
| InChI | InChI=1S/C18H15ClN2OS/c1-12-6-2-5-9-16(12)21-17(22)10-13-11-23-18(20-13)14-7-3-4-8-15(14)19/h2-9,11H,10H2,1H3,(H,21,22) |
| InChIKey | FPSFIGXLFOPKQG-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.85 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |