C24H27ClN4OS — CID 36565957
2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]-N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]acetamide (PubChem CID 36565957) has the molecular formula C24H27ClN4OS and a molecular weight of 455.03 g/mol. Its IUPAC name is 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]-N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]acetamide.
| Compound Name | 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]-N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]acetamide |
|---|---|
| PubChem CID | 36565957 |
| Molecular Formula | C24H27ClN4OS |
| Molecular Weight | 455.03 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]-N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]acetamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)Cc3csc(-c4ccccc4Cl)n3)c(C)c2)CC1 |
| InChI | InChI=1S/C24H27ClN4OS/c1-3-28-10-12-29(13-11-28)19-8-9-22(17(2)14-19)27-23(30)15-18-16-31-24(26-18)20-6-4-5-7-21(20)25/h4-9,14,16H,3,10-13,15H2,1-2H3,(H,27,30) |
| InChIKey | VWQAGYGHUHXHFA-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.03 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|