C24H29N5O2 — CID 32761024
N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]-2-(3-methyl-4-oxophthalazin-1-yl)acetamide (PubChem CID 32761024) has the molecular formula C24H29N5O2 and a molecular weight of 419.53 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]-2-(3-methyl-4-oxophthalazin-1-yl)acetamide.
| Compound Name | N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]-2-(3-methyl-4-oxophthalazin-1-yl)acetamide |
|---|---|
| PubChem CID | 32761024 |
| Molecular Formula | C24H29N5O2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]-2-(3-methyl-4-oxophthalazin-1-yl)acetamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)Cc3nn(C)c(=O)c4ccccc34)c(C)c2)CC1 |
| InChI | InChI=1S/C24H29N5O2/c1-4-28-11-13-29(14-12-28)18-9-10-21(17(2)15-18)25-23(30)16-22-19-7-5-6-8-20(19)24(31)27(3)26-22/h5-10,15H,4,11-14,16H2,1-3H3,(H,25,30) |
| InChIKey | ARSOKGHDQPFPJA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|