C23H27N5O2 — CID 55457066
N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]-2-(3-methyl-4-oxophthalazin-1-yl)acetamide (PubChem CID 55457066) has the molecular formula C23H27N5O2 and a molecular weight of 405.50 g/mol. Its IUPAC name is N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]-2-(3-methyl-4-oxophthalazin-1-yl)acetamide.
| Compound Name | N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]-2-(3-methyl-4-oxophthalazin-1-yl)acetamide |
|---|---|
| PubChem CID | 55457066 |
| Molecular Formula | C23H27N5O2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]-2-(3-methyl-4-oxophthalazin-1-yl)acetamide |
| SMILES | Cc1cc(NC(=O)Cc2nn(C)c(=O)c3ccccc23)ccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C23H27N5O2/c1-16-14-17(8-9-21(16)28-12-10-26(2)11-13-28)24-22(29)15-20-18-6-4-5-7-19(18)23(30)27(3)25-20/h4-9,14H,10-13,15H2,1-3H3,(H,24,29) |
| InChIKey | BUMVAXYZFNMGND-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|