C24H20N4O3 — CID 55796721
N-[3-[[2-(3-methyl-4-oxophthalazin-1-yl)acetyl]amino]phenyl]benzamide (PubChem CID 55796721) has the molecular formula C24H20N4O3 and a molecular weight of 412.45 g/mol. Its IUPAC name is N-[3-[[2-(3-methyl-4-oxophthalazin-1-yl)acetyl]amino]phenyl]benzamide.
| Compound Name | N-[3-[[2-(3-methyl-4-oxophthalazin-1-yl)acetyl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 55796721 |
| Molecular Formula | C24H20N4O3 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | N-[3-[[2-(3-methyl-4-oxophthalazin-1-yl)acetyl]amino]phenyl]benzamide |
| SMILES | Cn1nc(CC(=O)Nc2cccc(NC(=O)c3ccccc3)c2)c2ccccc2c1=O |
| InChI | InChI=1S/C24H20N4O3/c1-28-24(31)20-13-6-5-12-19(20)21(27-28)15-22(29)25-17-10-7-11-18(14-17)26-23(30)16-8-3-2-4-9-16/h2-14H,15H2,1H3,(H,25,29)(H,26,30) |
| InChIKey | SXLMANYTYSVACR-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |