C18H17N5O3 — CID 51132977
2-(3-methyl-4-oxophthalazin-1-yl)-N-[2-oxo-2-(pyridin-3-ylamino)ethyl]acetamide (PubChem CID 51132977) has the molecular formula C18H17N5O3 and a molecular weight of 351.37 g/mol. Its IUPAC name is 2-(3-methyl-4-oxophthalazin-1-yl)-N-[2-oxo-2-(pyridin-3-ylamino)ethyl]acetamide.
| Compound Name | 2-(3-methyl-4-oxophthalazin-1-yl)-N-[2-oxo-2-(pyridin-3-ylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 51132977 |
| Molecular Formula | C18H17N5O3 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 2-(3-methyl-4-oxophthalazin-1-yl)-N-[2-oxo-2-(pyridin-3-ylamino)ethyl]acetamide |
| SMILES | Cn1nc(CC(=O)NCC(=O)Nc2cccnc2)c2ccccc2c1=O |
| InChI | InChI=1S/C18H17N5O3/c1-23-18(26)14-7-3-2-6-13(14)15(22-23)9-16(24)20-11-17(25)21-12-5-4-8-19-10-12/h2-8,10H,9,11H2,1H3,(H,20,24)(H,21,25) |
| InChIKey | NAEQFTDVTLVGQP-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |