C27H33N5O2 — CID 55358562
3-(3-cyclopropyl-4-oxoquinazolin-2-yl)-N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]propanamide (PubChem CID 55358562) has the molecular formula C27H33N5O2 and a molecular weight of 459.59 g/mol. Its IUPAC name is 3-(3-cyclopropyl-4-oxoquinazolin-2-yl)-N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]propanamide.
| Compound Name | 3-(3-cyclopropyl-4-oxoquinazolin-2-yl)-N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]propanamide |
|---|---|
| PubChem CID | 55358562 |
| Molecular Formula | C27H33N5O2 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | 3-(3-cyclopropyl-4-oxoquinazolin-2-yl)-N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]propanamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)CCc3nc4ccccc4c(=O)n3C3CC3)c(C)c2)CC1 |
| InChI | InChI=1S/C27H33N5O2/c1-3-30-14-16-31(17-15-30)21-10-11-23(19(2)18-21)29-26(33)13-12-25-28-24-7-5-4-6-22(24)27(34)32(25)20-8-9-20/h4-7,10-11,18,20H,3,8-9,12-17H2,1-2H3,(H,29,33) |
| InChIKey | KAQCFYZOVYHCSZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|