C17H18N2O5 — CID 43050906
(2-methoxy-2-oxoethyl) 3-(3-cyclopropyl-4-oxoquinazolin-2-yl)propanoate (PubChem CID 43050906) has the molecular formula C17H18N2O5 and a molecular weight of 330.34 g/mol. Its IUPAC name is (2-methoxy-2-oxoethyl) 3-(3-cyclopropyl-4-oxoquinazolin-2-yl)propanoate.
| Compound Name | (2-methoxy-2-oxoethyl) 3-(3-cyclopropyl-4-oxoquinazolin-2-yl)propanoate |
|---|---|
| PubChem CID | 43050906 |
| Molecular Formula | C17H18N2O5 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | (2-methoxy-2-oxoethyl) 3-(3-cyclopropyl-4-oxoquinazolin-2-yl)propanoate |
| SMILES | COC(=O)COC(=O)CCc1nc2ccccc2c(=O)n1C1CC1 |
| InChI | InChI=1S/C17H18N2O5/c1-23-16(21)10-24-15(20)9-8-14-18-13-5-3-2-4-12(13)17(22)19(14)11-6-7-11/h2-5,11H,6-10H2,1H3 |
| InChIKey | FCICAQGCXFIFAE-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 87.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |