C29H26N4O4 — CID 46809068
[2-(2-benzhydrylidenehydrazinyl)-2-oxoethyl] 3-(3-cyclopropyl-4-oxoquinazolin-2-yl)propanoate (PubChem CID 46809068) has the molecular formula C29H26N4O4 and a molecular weight of 494.55 g/mol. Its IUPAC name is [2-(2-benzhydrylidenehydrazinyl)-2-oxoethyl] 3-(3-cyclopropyl-4-oxoquinazolin-2-yl)propanoate.
| Compound Name | [2-(2-benzhydrylidenehydrazinyl)-2-oxoethyl] 3-(3-cyclopropyl-4-oxoquinazolin-2-yl)propanoate |
|---|---|
| PubChem CID | 46809068 |
| Molecular Formula | C29H26N4O4 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | [2-(2-benzhydrylidenehydrazinyl)-2-oxoethyl] 3-(3-cyclopropyl-4-oxoquinazolin-2-yl)propanoate |
| SMILES | O=C(COC(=O)CCc1nc2ccccc2c(=O)n1C1CC1)NN=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H26N4O4/c34-26(31-32-28(20-9-3-1-4-10-20)21-11-5-2-6-12-21)19-37-27(35)18-17-25-30-24-14-8-7-13-23(24)29(36)33(25)22-15-16-22/h1-14,22H,15-19H2,(H,31,34) |
| InChIKey | IFGNEOGXKMPXMQ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 102.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|