C21H20N2O6 — CID 43025388
methyl 5-[3-(3-cyclopropyl-4-oxoquinazolin-2-yl)propanoyloxymethyl]furan-2-carboxylate (PubChem CID 43025388) has the molecular formula C21H20N2O6 and a molecular weight of 396.40 g/mol. Its IUPAC name is methyl 5-[3-(3-cyclopropyl-4-oxoquinazolin-2-yl)propanoyloxymethyl]furan-2-carboxylate.
| Compound Name | methyl 5-[3-(3-cyclopropyl-4-oxoquinazolin-2-yl)propanoyloxymethyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 43025388 |
| Molecular Formula | C21H20N2O6 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | methyl 5-[3-(3-cyclopropyl-4-oxoquinazolin-2-yl)propanoyloxymethyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(COC(=O)CCc2nc3ccccc3c(=O)n2C2CC2)o1 |
| InChI | InChI=1S/C21H20N2O6/c1-27-21(26)17-9-8-14(29-17)12-28-19(24)11-10-18-22-16-5-3-2-4-15(16)20(25)23(18)13-6-7-13/h2-5,8-9,13H,6-7,10-12H2,1H3 |
| InChIKey | QNMKSNPKCDALCM-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 100.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |