C23H24N4O3S — CID 56579902
S-[4-[3-(3-cyclopropyl-4-oxoquinazolin-2-yl)propanoylamino]phenyl] N,N-dimethylcarbamothioate (PubChem CID 56579902) has the molecular formula C23H24N4O3S and a molecular weight of 436.54 g/mol. Its IUPAC name is S-[4-[3-(3-cyclopropyl-4-oxoquinazolin-2-yl)propanoylamino]phenyl] N,N-dimethylcarbamothioate.
| Compound Name | S-[4-[3-(3-cyclopropyl-4-oxoquinazolin-2-yl)propanoylamino]phenyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 56579902 |
| Molecular Formula | C23H24N4O3S |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | S-[4-[3-(3-cyclopropyl-4-oxoquinazolin-2-yl)propanoylamino]phenyl] N,N-dimethylcarbamothioate |
| SMILES | CN(C)C(=O)Sc1ccc(NC(=O)CCc2nc3ccccc3c(=O)n2C2CC2)cc1 |
| InChI | InChI=1S/C23H24N4O3S/c1-26(2)23(30)31-17-11-7-15(8-12-17)24-21(28)14-13-20-25-19-6-4-3-5-18(19)22(29)27(20)16-9-10-16/h3-8,11-12,16H,9-10,13-14H2,1-2H3,(H,24,28) |
| InChIKey | GQKQKPKRVQJBQB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|