C27H24FN3O3 — CID 55632270
3-(3-cyclopropyl-4-oxoquinazolin-2-yl)-N-[3-[(4-fluorophenyl)methoxy]phenyl]propanamide (PubChem CID 55632270) has the molecular formula C27H24FN3O3 and a molecular weight of 457.51 g/mol. Its IUPAC name is 3-(3-cyclopropyl-4-oxoquinazolin-2-yl)-N-[3-[(4-fluorophenyl)methoxy]phenyl]propanamide.
| Compound Name | 3-(3-cyclopropyl-4-oxoquinazolin-2-yl)-N-[3-[(4-fluorophenyl)methoxy]phenyl]propanamide |
|---|---|
| PubChem CID | 55632270 |
| Molecular Formula | C27H24FN3O3 |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 3-(3-cyclopropyl-4-oxoquinazolin-2-yl)-N-[3-[(4-fluorophenyl)methoxy]phenyl]propanamide |
| SMILES | O=C(CCc1nc2ccccc2c(=O)n1C1CC1)Nc1cccc(OCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C27H24FN3O3/c28-19-10-8-18(9-11-19)17-34-22-5-3-4-20(16-22)29-26(32)15-14-25-30-24-7-2-1-6-23(24)27(33)31(25)21-12-13-21/h1-11,16,21H,12-15,17H2,(H,29,32) |
| InChIKey | BPVMPMWVKDXECV-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |