C24H35N5OS — CID 56515562
N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidine-4-carboxamide (PubChem CID 56515562) has the molecular formula C24H35N5OS and a molecular weight of 441.65 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidine-4-carboxamide.
| Compound Name | N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 56515562 |
| Molecular Formula | C24H35N5OS |
| Molecular Weight | 441.65 g/mol |
| Exact Mass | 441.26 |
| IUPAC Name | N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidine-4-carboxamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)C3CCN(Cc4csc(C)n4)CC3)c(C)c2)CC1 |
| InChI | InChI=1S/C24H35N5OS/c1-4-27-11-13-29(14-12-27)22-5-6-23(18(2)15-22)26-24(30)20-7-9-28(10-8-20)16-21-17-31-19(3)25-21/h5-6,15,17,20H,4,7-14,16H2,1-3H3,(H,26,30) |
| InChIKey | OQQZUFZGBHEDTO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 51.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.65 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|