C21H27N5O2S — CID 56582320
1-[(2-methyl-1,3-thiazol-4-yl)methyl]-N-[4-(prop-2-enylcarbamoylamino)phenyl]piperidine-4-carboxamide (PubChem CID 56582320) has the molecular formula C21H27N5O2S and a molecular weight of 413.55 g/mol. Its IUPAC name is 1-[(2-methyl-1,3-thiazol-4-yl)methyl]-N-[4-(prop-2-enylcarbamoylamino)phenyl]piperidine-4-carboxamide.
| Compound Name | 1-[(2-methyl-1,3-thiazol-4-yl)methyl]-N-[4-(prop-2-enylcarbamoylamino)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 56582320 |
| Molecular Formula | C21H27N5O2S |
| Molecular Weight | 413.55 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | 1-[(2-methyl-1,3-thiazol-4-yl)methyl]-N-[4-(prop-2-enylcarbamoylamino)phenyl]piperidine-4-carboxamide |
| SMILES | C=CCNC(=O)Nc1ccc(NC(=O)C2CCN(Cc3csc(C)n3)CC2)cc1 |
| InChI | InChI=1S/C21H27N5O2S/c1-3-10-22-21(28)25-18-6-4-17(5-7-18)24-20(27)16-8-11-26(12-9-16)13-19-14-29-15(2)23-19/h3-7,14,16H,1,8-13H2,2H3,(H,24,27)(H2,22,25,28) |
| InChIKey | CHKQRYBRRWFFCN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.55 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|