C18H26Cl2N4O2S — CID 119419388
N-(3-amino-4-methoxyphenyl)-1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidine-4-carboxamide;dihydrochloride (PubChem CID 119419388) has the molecular formula C18H26Cl2N4O2S and a molecular weight of 433.41 g/mol. Its IUPAC name is N-(3-amino-4-methoxyphenyl)-1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidine-4-carboxamide;dihydrochloride.
| Compound Name | N-(3-amino-4-methoxyphenyl)-1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidine-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119419388 |
| Molecular Formula | C18H26Cl2N4O2S |
| Molecular Weight | 433.41 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | N-(3-amino-4-methoxyphenyl)-1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidine-4-carboxamide;dihydrochloride |
| SMILES | COc1ccc(NC(=O)C2CCN(Cc3csc(C)n3)CC2)cc1N.Cl.Cl |
| InChI | InChI=1S/C18H24N4O2S.2ClH/c1-12-20-15(11-25-12)10-22-7-5-13(6-8-22)18(23)21-14-3-4-17(24-2)16(19)9-14;;/h3-4,9,11,13H,5-8,10,19H2,1-2H3,(H,21,23);2*1H |
| InChIKey | YCTPWNKSPKTIPD-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|