C13H20N4O4S — CID 119420188
N-(3-amino-4-methoxyphenyl)-1-sulfamoylpiperidine-4-carboxamide (PubChem CID 119420188) has the molecular formula C13H20N4O4S and a molecular weight of 328.39 g/mol. Its IUPAC name is N-(3-amino-4-methoxyphenyl)-1-sulfamoylpiperidine-4-carboxamide.
| Compound Name | N-(3-amino-4-methoxyphenyl)-1-sulfamoylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 119420188 |
| Molecular Formula | C13H20N4O4S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | N-(3-amino-4-methoxyphenyl)-1-sulfamoylpiperidine-4-carboxamide |
| SMILES | COc1ccc(NC(=O)C2CCN(S(N)(=O)=O)CC2)cc1N |
| InChI | InChI=1S/C13H20N4O4S/c1-21-12-3-2-10(8-11(12)14)16-13(18)9-4-6-17(7-5-9)22(15,19)20/h2-3,8-9H,4-7,14H2,1H3,(H,16,18)(H2,15,19,20) |
| InChIKey | LBSMBDBJCUGUGB-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 127.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|