C18H26N4O3 — CID 119419829
N-(3-amino-4-methoxyphenyl)-1-(pyrrolidine-1-carbonyl)piperidine-4-carboxamide (PubChem CID 119419829) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is N-(3-amino-4-methoxyphenyl)-1-(pyrrolidine-1-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-(3-amino-4-methoxyphenyl)-1-(pyrrolidine-1-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 119419829 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | N-(3-amino-4-methoxyphenyl)-1-(pyrrolidine-1-carbonyl)piperidine-4-carboxamide |
| SMILES | COc1ccc(NC(=O)C2CCN(C(=O)N3CCCC3)CC2)cc1N |
| InChI | InChI=1S/C18H26N4O3/c1-25-16-5-4-14(12-15(16)19)20-17(23)13-6-10-22(11-7-13)18(24)21-8-2-3-9-21/h4-5,12-13H,2-3,6-11,19H2,1H3,(H,20,23) |
| InChIKey | JHEPZZCJCHDIDQ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|