C17H23N3O4 — CID 43004509
N-(5-acetamido-2-methoxyphenyl)-1-acetylpiperidine-4-carboxamide (PubChem CID 43004509) has the molecular formula C17H23N3O4 and a molecular weight of 333.39 g/mol. Its IUPAC name is N-(5-acetamido-2-methoxyphenyl)-1-acetylpiperidine-4-carboxamide.
| Compound Name | N-(5-acetamido-2-methoxyphenyl)-1-acetylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 43004509 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | N-(5-acetamido-2-methoxyphenyl)-1-acetylpiperidine-4-carboxamide |
| SMILES | COc1ccc(NC(C)=O)cc1NC(=O)C1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C17H23N3O4/c1-11(21)18-14-4-5-16(24-3)15(10-14)19-17(23)13-6-8-20(9-7-13)12(2)22/h4-5,10,13H,6-9H2,1-3H3,(H,18,21)(H,19,23) |
| InChIKey | DOCASCKBIGPJMR-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |