C14H19N3O5S — CID 90513267
N-(5-acetamido-2-methoxyphenyl)-1-methylsulfonylazetidine-3-carboxamide (PubChem CID 90513267) has the molecular formula C14H19N3O5S and a molecular weight of 341.39 g/mol. Its IUPAC name is N-(5-acetamido-2-methoxyphenyl)-1-methylsulfonylazetidine-3-carboxamide.
| Compound Name | N-(5-acetamido-2-methoxyphenyl)-1-methylsulfonylazetidine-3-carboxamide |
|---|---|
| PubChem CID | 90513267 |
| Molecular Formula | C14H19N3O5S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | N-(5-acetamido-2-methoxyphenyl)-1-methylsulfonylazetidine-3-carboxamide |
| SMILES | COc1ccc(NC(C)=O)cc1NC(=O)C1CN(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C14H19N3O5S/c1-9(18)15-11-4-5-13(22-2)12(6-11)16-14(19)10-7-17(8-10)23(3,20)21/h4-6,10H,7-8H2,1-3H3,(H,15,18)(H,16,19) |
| InChIKey | ACFCLXSQRAJIPO-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |