C16H23N3O5S — CID 25469701
(3R)-N-(5-acetamido-2-methoxyphenyl)-1-methylsulfonylpiperidine-3-carboxamide (PubChem CID 25469701) has the molecular formula C16H23N3O5S and a molecular weight of 369.44 g/mol. Its IUPAC name is (3R)-N-(5-acetamido-2-methoxyphenyl)-1-methylsulfonylpiperidine-3-carboxamide.
| Compound Name | (3R)-N-(5-acetamido-2-methoxyphenyl)-1-methylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 25469701 |
| Molecular Formula | C16H23N3O5S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | (3R)-N-(5-acetamido-2-methoxyphenyl)-1-methylsulfonylpiperidine-3-carboxamide |
| SMILES | COc1ccc(NC(C)=O)cc1NC(=O)[C@@H]1CCCN(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C16H23N3O5S/c1-11(20)17-13-6-7-15(24-2)14(9-13)18-16(21)12-5-4-8-19(10-12)25(3,22)23/h6-7,9,12H,4-5,8,10H2,1-3H3,(H,17,20)(H,18,21)/t12-/m1/s1 |
| InChIKey | FCJADVBVEXGALE-GFCCVEGCSA-N |
| XLogP | 1.26 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |