C21H26N4O4S — CID 55766233
N-[2-methyl-5-(phenylcarbamoylamino)phenyl]-1-methylsulfonylpiperidine-3-carboxamide (PubChem CID 55766233) has the molecular formula C21H26N4O4S and a molecular weight of 430.53 g/mol. Its IUPAC name is N-[2-methyl-5-(phenylcarbamoylamino)phenyl]-1-methylsulfonylpiperidine-3-carboxamide.
| Compound Name | N-[2-methyl-5-(phenylcarbamoylamino)phenyl]-1-methylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 55766233 |
| Molecular Formula | C21H26N4O4S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | N-[2-methyl-5-(phenylcarbamoylamino)phenyl]-1-methylsulfonylpiperidine-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)Nc2ccccc2)cc1NC(=O)C1CCCN(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C21H26N4O4S/c1-15-10-11-18(23-21(27)22-17-8-4-3-5-9-17)13-19(15)24-20(26)16-7-6-12-25(14-16)30(2,28)29/h3-5,8-11,13,16H,6-7,12,14H2,1-2H3,(H,24,26)(H2,22,23,27) |
| InChIKey | ZHGLCDJWLXUGLI-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |