C16H23N3O3 — CID 120617184
(2S,4S)-N-(5-acetamido-2-methoxyphenyl)-2-methylpiperidine-4-carboxamide (PubChem CID 120617184) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is (2S,4S)-N-(5-acetamido-2-methoxyphenyl)-2-methylpiperidine-4-carboxamide.
| Compound Name | (2S,4S)-N-(5-acetamido-2-methoxyphenyl)-2-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 120617184 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | (2S,4S)-N-(5-acetamido-2-methoxyphenyl)-2-methylpiperidine-4-carboxamide |
| SMILES | COc1ccc(NC(C)=O)cc1NC(=O)[C@H]1CCN[C@@H](C)C1 |
| InChI | InChI=1S/C16H23N3O3/c1-10-8-12(6-7-17-10)16(21)19-14-9-13(18-11(2)20)4-5-15(14)22-3/h4-5,9-10,12,17H,6-8H2,1-3H3,(H,18,20)(H,19,21)/t10-,12-/m0/s1 |
| InChIKey | ALYPKGFPHBQBPR-JQWIXIFHSA-N |
| XLogP | 1.98 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |