C16H24N2O4 — CID 120629024
(2S,4S)-2-methyl-N-(2,3,4-trimethoxyphenyl)piperidine-4-carboxamide (PubChem CID 120629024) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is (2S,4S)-2-methyl-N-(2,3,4-trimethoxyphenyl)piperidine-4-carboxamide.
| Compound Name | (2S,4S)-2-methyl-N-(2,3,4-trimethoxyphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 120629024 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | (2S,4S)-2-methyl-N-(2,3,4-trimethoxyphenyl)piperidine-4-carboxamide |
| SMILES | COc1ccc(NC(=O)[C@H]2CCN[C@@H](C)C2)c(OC)c1OC |
| InChI | InChI=1S/C16H24N2O4/c1-10-9-11(7-8-17-10)16(19)18-12-5-6-13(20-2)15(22-4)14(12)21-3/h5-6,10-11,17H,7-9H2,1-4H3,(H,18,19)/t10-,11-/m0/s1 |
| InChIKey | YYSBHDIYONOUKE-QWRGUYRKSA-N |
| XLogP | 2.04 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |