C14H21ClN2O4 — CID 119761624
N-(2,3,4-trimethoxyphenyl)pyrrolidine-3-carboxamide;hydrochloride (PubChem CID 119761624) has the molecular formula C14H21ClN2O4 and a molecular weight of 316.79 g/mol. Its IUPAC name is N-(2,3,4-trimethoxyphenyl)pyrrolidine-3-carboxamide;hydrochloride.
| Compound Name | N-(2,3,4-trimethoxyphenyl)pyrrolidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119761624 |
| Molecular Formula | C14H21ClN2O4 |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | N-(2,3,4-trimethoxyphenyl)pyrrolidine-3-carboxamide;hydrochloride |
| SMILES | COc1ccc(NC(=O)C2CCNC2)c(OC)c1OC.Cl |
| InChI | InChI=1S/C14H20N2O4.ClH/c1-18-11-5-4-10(12(19-2)13(11)20-3)16-14(17)9-6-7-15-8-9;/h4-5,9,15H,6-8H2,1-3H3,(H,16,17);1H |
| InChIKey | SBERNJJXZKAWRA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |