C16H23N3O2 — CID 120620818
(2S,4S)-N-(3-acetamido-4-methylphenyl)-2-methylpiperidine-4-carboxamide (PubChem CID 120620818) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is (2S,4S)-N-(3-acetamido-4-methylphenyl)-2-methylpiperidine-4-carboxamide.
| Compound Name | (2S,4S)-N-(3-acetamido-4-methylphenyl)-2-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 120620818 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | (2S,4S)-N-(3-acetamido-4-methylphenyl)-2-methylpiperidine-4-carboxamide |
| SMILES | CC(=O)Nc1cc(NC(=O)[C@H]2CCN[C@@H](C)C2)ccc1C |
| InChI | InChI=1S/C16H23N3O2/c1-10-4-5-14(9-15(10)18-12(3)20)19-16(21)13-6-7-17-11(2)8-13/h4-5,9,11,13,17H,6-8H2,1-3H3,(H,18,20)(H,19,21)/t11-,13-/m0/s1 |
| InChIKey | JYWLAYXSSUXNTH-AAEUAGOBSA-N |
| XLogP | 2.28 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |