C16H21ClN2O4 — CID 6466145
1-acetyl-N-(4-chloro-2,5-dimethoxyphenyl)piperidine-4-carboxamide (PubChem CID 6466145) has the molecular formula C16H21ClN2O4 and a molecular weight of 340.81 g/mol. Its IUPAC name is 1-acetyl-N-(4-chloro-2,5-dimethoxyphenyl)piperidine-4-carboxamide.
| Compound Name | 1-acetyl-N-(4-chloro-2,5-dimethoxyphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 6466145 |
| Molecular Formula | C16H21ClN2O4 |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 1-acetyl-N-(4-chloro-2,5-dimethoxyphenyl)piperidine-4-carboxamide |
| SMILES | COc1cc(NC(=O)C2CCN(C(C)=O)CC2)c(OC)cc1Cl |
| InChI | InChI=1S/C16H21ClN2O4/c1-10(20)19-6-4-11(5-7-19)16(21)18-13-9-14(22-2)12(17)8-15(13)23-3/h8-9,11H,4-7H2,1-3H3,(H,18,21) |
| InChIKey | FQQITRTXXJYXJZ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |