C14H18ClNO3S — CID 110864457
N-(4-chloro-2,5-dimethoxyphenyl)thiane-4-carboxamide (PubChem CID 110864457) has the molecular formula C14H18ClNO3S and a molecular weight of 315.82 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)thiane-4-carboxamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)thiane-4-carboxamide |
|---|---|
| PubChem CID | 110864457 |
| Molecular Formula | C14H18ClNO3S |
| Molecular Weight | 315.82 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)thiane-4-carboxamide |
| SMILES | COc1cc(NC(=O)C2CCSCC2)c(OC)cc1Cl |
| InChI | InChI=1S/C14H18ClNO3S/c1-18-12-8-11(13(19-2)7-10(12)15)16-14(17)9-3-5-20-6-4-9/h7-9H,3-6H2,1-2H3,(H,16,17) |
| InChIKey | XTGZWGKNWLOEQP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.82 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |