C9H12ClN3O3 — CID 43163908
1-amino-3-(4-chloro-2,5-dimethoxyphenyl)urea (PubChem CID 43163908) has the molecular formula C9H12ClN3O3 and a molecular weight of 245.67 g/mol. Its IUPAC name is 1-amino-3-(4-chloro-2,5-dimethoxyphenyl)urea.
| Compound Name | 1-amino-3-(4-chloro-2,5-dimethoxyphenyl)urea |
|---|---|
| PubChem CID | 43163908 |
| Molecular Formula | C9H12ClN3O3 |
| Molecular Weight | 245.67 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 1-amino-3-(4-chloro-2,5-dimethoxyphenyl)urea |
| SMILES | COc1cc(NC(=O)NN)c(OC)cc1Cl |
| InChI | InChI=1S/C9H12ClN3O3/c1-15-7-4-6(12-9(14)13-11)8(16-2)3-5(7)10/h3-4H,11H2,1-2H3,(H2,12,13,14) |
| InChIKey | MKIHNJMCQSDIRW-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.67 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|