C17H19ClN2O4 — CID 46860261
1-(4-chloro-2,5-dimethoxyphenyl)-3-(4-methoxy-2-methylphenyl)urea (PubChem CID 46860261) has the molecular formula C17H19ClN2O4 and a molecular weight of 350.80 g/mol. Its IUPAC name is 1-(4-chloro-2,5-dimethoxyphenyl)-3-(4-methoxy-2-methylphenyl)urea.
| Compound Name | 1-(4-chloro-2,5-dimethoxyphenyl)-3-(4-methoxy-2-methylphenyl)urea |
|---|---|
| PubChem CID | 46860261 |
| Molecular Formula | C17H19ClN2O4 |
| Molecular Weight | 350.80 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 1-(4-chloro-2,5-dimethoxyphenyl)-3-(4-methoxy-2-methylphenyl)urea |
| SMILES | COc1ccc(NC(=O)Nc2cc(OC)c(Cl)cc2OC)c(C)c1 |
| InChI | InChI=1S/C17H19ClN2O4/c1-10-7-11(22-2)5-6-13(10)19-17(21)20-14-9-15(23-3)12(18)8-16(14)24-4/h5-9H,1-4H3,(H2,19,20,21) |
| InChIKey | ZYNAUQNEMOGPCE-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.80 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |