C17H17ClN2O5 — CID 108865332
[3-[(4-chloro-2,5-dimethoxyphenyl)carbamoylamino]phenyl] acetate (PubChem CID 108865332) has the molecular formula C17H17ClN2O5 and a molecular weight of 364.79 g/mol. Its IUPAC name is [3-[(4-chloro-2,5-dimethoxyphenyl)carbamoylamino]phenyl] acetate.
| Compound Name | [3-[(4-chloro-2,5-dimethoxyphenyl)carbamoylamino]phenyl] acetate |
|---|---|
| PubChem CID | 108865332 |
| Molecular Formula | C17H17ClN2O5 |
| Molecular Weight | 364.79 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | [3-[(4-chloro-2,5-dimethoxyphenyl)carbamoylamino]phenyl] acetate |
| SMILES | COc1cc(NC(=O)Nc2cccc(OC(C)=O)c2)c(OC)cc1Cl |
| InChI | InChI=1S/C17H17ClN2O5/c1-10(21)25-12-6-4-5-11(7-12)19-17(22)20-14-9-15(23-2)13(18)8-16(14)24-3/h4-9H,1-3H3,(H2,19,20,22) |
| InChIKey | QJXZUPPFEGBWBJ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.79 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|