C17H18ClN3O4 — CID 108992307
N-[4-[(4-chloro-2,5-dimethoxyphenyl)carbamoylamino]phenyl]acetamide (PubChem CID 108992307) has the molecular formula C17H18ClN3O4 and a molecular weight of 363.80 g/mol. Its IUPAC name is N-[4-[(4-chloro-2,5-dimethoxyphenyl)carbamoylamino]phenyl]acetamide.
| Compound Name | N-[4-[(4-chloro-2,5-dimethoxyphenyl)carbamoylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 108992307 |
| Molecular Formula | C17H18ClN3O4 |
| Molecular Weight | 363.80 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | N-[4-[(4-chloro-2,5-dimethoxyphenyl)carbamoylamino]phenyl]acetamide |
| SMILES | COc1cc(NC(=O)Nc2ccc(NC(C)=O)cc2)c(OC)cc1Cl |
| InChI | InChI=1S/C17H18ClN3O4/c1-10(22)19-11-4-6-12(7-5-11)20-17(23)21-14-9-15(24-2)13(18)8-16(14)25-3/h4-9H,1-3H3,(H,19,22)(H2,20,21,23) |
| InChIKey | KZNSQPHECLRAQJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.80 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |