C15H16ClN3O3 — CID 113022464
N-[6-(4-chloro-2,5-dimethoxyanilino)-3-pyridinyl]acetamide (PubChem CID 113022464) has the molecular formula C15H16ClN3O3 and a molecular weight of 321.76 g/mol. Its IUPAC name is N-[6-(4-chloro-2,5-dimethoxyanilino)-3-pyridinyl]acetamide.
| Compound Name | N-[6-(4-chloro-2,5-dimethoxyanilino)-3-pyridinyl]acetamide |
|---|---|
| PubChem CID | 113022464 |
| Molecular Formula | C15H16ClN3O3 |
| Molecular Weight | 321.76 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | N-[6-(4-chloro-2,5-dimethoxyanilino)-3-pyridinyl]acetamide |
| SMILES | COc1cc(Nc2ccc(NC(C)=O)cn2)c(OC)cc1Cl |
| InChI | InChI=1S/C15H16ClN3O3/c1-9(20)18-10-4-5-15(17-8-10)19-12-7-13(21-2)11(16)6-14(12)22-3/h4-8H,1-3H3,(H,17,19)(H,18,20) |
| InChIKey | YGCLZHXHHZRZDF-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.76 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |